C28H21N3O4 — CID 90906692
3-[5-(4-hydroxy-N-methylanilino)pyridine-2-carbonyl]-5-indol-1-ylbenzoic acid (PubChem CID 90906692) has the molecular formula C28H21N3O4 and a molecular weight of 463.49 g/mol. Its IUPAC name is 3-[5-(4-hydroxy-N-methylanilino)pyridine-2-carbonyl]-5-indol-1-ylbenzoic acid.
| Compound Name | 3-[5-(4-hydroxy-N-methylanilino)pyridine-2-carbonyl]-5-indol-1-ylbenzoic acid |
|---|---|
| PubChem CID | 90906692 |
| Molecular Formula | C28H21N3O4 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 3-[5-(4-hydroxy-N-methylanilino)pyridine-2-carbonyl]-5-indol-1-ylbenzoic acid |
| SMILES | CN(c1ccc(O)cc1)c1ccc(C(=O)c2cc(C(=O)O)cc(-n3ccc4ccccc43)c2)nc1 |
| InChI | InChI=1S/C28H21N3O4/c1-30(21-6-9-24(32)10-7-21)22-8-11-25(29-17-22)27(33)19-14-20(28(34)35)16-23(15-19)31-13-12-18-4-2-3-5-26(18)31/h2-17,32H,1H3,(H,34,35) |
| InChIKey | HKABJLQERQFHBJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |