C4H4Cl2N2 — CID 90907997
4,5-dichloro-1,4-dihydropyrimidine (PubChem CID 90907997) has the molecular formula C4H4Cl2N2 and a molecular weight of 151.00 g/mol. Its IUPAC name is 4,5-dichloro-1,4-dihydropyrimidine.
| Compound Name | 4,5-dichloro-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 90907997 |
| Molecular Formula | C4H4Cl2N2 |
| Molecular Weight | 151.00 g/mol |
| Exact Mass | 149.98 |
| IUPAC Name | 4,5-dichloro-1,4-dihydropyrimidine |
| SMILES | ClC1=CNC=NC1Cl |
| InChI | InChI=1S/C4H4Cl2N2/c5-3-1-7-2-8-4(3)6/h1-2,4H,(H,7,8) |
| InChIKey | VDVWBSVBRTWUDS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.00 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|