C8H17NO10 — CID 90908022
7-amino-4,4,5,5,6,6,7,7-octahydroxy-2-methylheptanoic acid (PubChem CID 90908022) has the molecular formula C8H17NO10 and a molecular weight of 287.22 g/mol. Its IUPAC name is 7-amino-4,4,5,5,6,6,7,7-octahydroxy-2-methylheptanoic acid.
| Compound Name | 7-amino-4,4,5,5,6,6,7,7-octahydroxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 90908022 |
| Molecular Formula | C8H17NO10 |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 7-amino-4,4,5,5,6,6,7,7-octahydroxy-2-methylheptanoic acid |
| SMILES | CC(CC(O)(O)C(O)(O)C(O)(O)C(N)(O)O)C(=O)O |
| InChI | InChI=1S/C8H17NO10/c1-3(4(10)11)2-5(12,13)6(14,15)7(16,17)8(9,18)19/h3,12-19H,2,9H2,1H3,(H,10,11) |
| InChIKey | OYOHPMUDCRNKBW-UHFFFAOYSA-N |
| XLogP | -5.26 |
| TPSA | 225.16 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | -5.26 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|