C21H22F3N3O6 — CID 90908175
[N-[(2-methylpropan-2-yl)oxycarbonyl]-3-[[(3-nitrophenyl)methylamino]methyl]anilino] 2,2,2-trifluoroacetate (PubChem CID 90908175) has the molecular formula C21H22F3N3O6 and a molecular weight of 469.42 g/mol. Its IUPAC name is [N-[(2-methylpropan-2-yl)oxycarbonyl]-3-[[(3-nitrophenyl)methylamino]methyl]anilino] 2,2,2-trifluoroacetate.
| Compound Name | [N-[(2-methylpropan-2-yl)oxycarbonyl]-3-[[(3-nitrophenyl)methylamino]methyl]anilino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90908175 |
| Molecular Formula | C21H22F3N3O6 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | [N-[(2-methylpropan-2-yl)oxycarbonyl]-3-[[(3-nitrophenyl)methylamino]methyl]anilino] 2,2,2-trifluoroacetate |
| SMILES | CC(C)(C)OC(=O)N(OC(=O)C(F)(F)F)c1cccc(CNCc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H22F3N3O6/c1-20(2,3)32-19(29)26(33-18(28)21(22,23)24)16-8-4-6-14(10-16)12-25-13-15-7-5-9-17(11-15)27(30)31/h4-11,25H,12-13H2,1-3H3 |
| InChIKey | XHFUMPSKIYGJAW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|