C11H9F3N2O5 — CID 121223954
methyl 2-(3-nitro-N-(2,2,2-trifluoroacetyl)anilino)acetate (PubChem CID 121223954) has the molecular formula C11H9F3N2O5 and a molecular weight of 306.20 g/mol. Its IUPAC name is methyl 2-(3-nitro-N-(2,2,2-trifluoroacetyl)anilino)acetate.
| Compound Name | methyl 2-(3-nitro-N-(2,2,2-trifluoroacetyl)anilino)acetate |
|---|---|
| PubChem CID | 121223954 |
| Molecular Formula | C11H9F3N2O5 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | methyl 2-(3-nitro-N-(2,2,2-trifluoroacetyl)anilino)acetate |
| SMILES | COC(=O)CN(C(=O)C(F)(F)F)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9F3N2O5/c1-21-9(17)6-15(10(18)11(12,13)14)7-3-2-4-8(5-7)16(19)20/h2-5H,6H2,1H3 |
| InChIKey | PBTQHRYHWMMZLV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|