C13H11F3N2O3S — CID 89298994
N-(2,3-dihydrothiophen-2-ylmethyl)-2,2,2-trifluoro-N-(3-nitrophenyl)acetamide (PubChem CID 89298994) has the molecular formula C13H11F3N2O3S and a molecular weight of 332.30 g/mol. Its IUPAC name is N-(2,3-dihydrothiophen-2-ylmethyl)-2,2,2-trifluoro-N-(3-nitrophenyl)acetamide.
| Compound Name | N-(2,3-dihydrothiophen-2-ylmethyl)-2,2,2-trifluoro-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 89298994 |
| Molecular Formula | C13H11F3N2O3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | N-(2,3-dihydrothiophen-2-ylmethyl)-2,2,2-trifluoro-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(N(CC1CC=CS1)c1cccc([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C13H11F3N2O3S/c14-13(15,16)12(19)17(8-11-5-2-6-22-11)9-3-1-4-10(7-9)18(20)21/h1-4,6-7,11H,5,8H2 |
| InChIKey | FPWIAFABRMJMQT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|