C12H13F3N2O3 — CID 91681070
N-ethyl-N-(2-ethyl-4-nitrophenyl)-2,2,2-trifluoroacetamide (PubChem CID 91681070) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is N-ethyl-N-(2-ethyl-4-nitrophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-ethyl-N-(2-ethyl-4-nitrophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91681070 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-ethyl-N-(2-ethyl-4-nitrophenyl)-2,2,2-trifluoroacetamide |
| SMILES | CCc1cc([N+](=O)[O-])ccc1N(CC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O3/c1-3-8-7-9(17(19)20)5-6-10(8)16(4-2)11(18)12(13,14)15/h5-7H,3-4H2,1-2H3 |
| InChIKey | VBQOOHCJZWBZFJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|