C19H25N3O2S — CID 90909335
1-(3-imidazol-1-ylpropyl)-4-pentyl-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 90909335) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-4-pentyl-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-4-pentyl-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 90909335 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-4-pentyl-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | CCCCCC1C(=O)C(=O)N(CCCn2ccnc2)C1c1cccs1 |
| InChI | InChI=1S/C19H25N3O2S/c1-2-3-4-7-15-17(16-8-5-13-25-16)22(19(24)18(15)23)11-6-10-21-12-9-20-14-21/h5,8-9,12-15,17H,2-4,6-7,10-11H2,1H3 |
| InChIKey | AYRBUMYAYJYVNX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|