C16H15N2O5- — CID 9090952
2-[[(3-methoxy-4-methylbenzoyl)amino]methyl]-4-nitrophenolate (PubChem CID 9090952) has the molecular formula C16H15N2O5- and a molecular weight of 315.31 g/mol. Its IUPAC name is 2-[[(3-methoxy-4-methylbenzoyl)amino]methyl]-4-nitrophenolate.
| Compound Name | 2-[[(3-methoxy-4-methylbenzoyl)amino]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 9090952 |
| Molecular Formula | C16H15N2O5- |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-[[(3-methoxy-4-methylbenzoyl)amino]methyl]-4-nitrophenolate |
| SMILES | COc1cc(C(=O)NCc2cc([N+](=O)[O-])ccc2[O-])ccc1C |
| InChI | InChI=1S/C16H16N2O5/c1-10-3-4-11(8-15(10)23-2)16(20)17-9-12-7-13(18(21)22)5-6-14(12)19/h3-8,19H,9H2,1-2H3,(H,17,20)/p-1 |
| InChIKey | XPLRYERMIJCOPM-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|