C35H46N2O4 — CID 90910179
tert-butyl 2-[1-[4-[[2-cyclopentyl-2-[4-[(3-oxo-1H-isoindol-2-yl)methyl]phenyl]acetyl]amino]butyl]cyclopropyl]acetate (PubChem CID 90910179) has the molecular formula C35H46N2O4 and a molecular weight of 558.76 g/mol. Its IUPAC name is tert-butyl 2-[1-[4-[[2-cyclopentyl-2-[4-[(3-oxo-1H-isoindol-2-yl)methyl]phenyl]acetyl]amino]butyl]cyclopropyl]acetate.
| Compound Name | tert-butyl 2-[1-[4-[[2-cyclopentyl-2-[4-[(3-oxo-1H-isoindol-2-yl)methyl]phenyl]acetyl]amino]butyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 90910179 |
| Molecular Formula | C35H46N2O4 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | tert-butyl 2-[1-[4-[[2-cyclopentyl-2-[4-[(3-oxo-1H-isoindol-2-yl)methyl]phenyl]acetyl]amino]butyl]cyclopropyl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(CCCCNC(=O)C(c2ccc(CN3Cc4ccccc4C3=O)cc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C35H46N2O4/c1-34(2,3)41-30(38)22-35(19-20-35)18-8-9-21-36-32(39)31(26-10-4-5-11-26)27-16-14-25(15-17-27)23-37-24-28-12-6-7-13-29(28)33(37)40/h6-7,12-17,26,31H,4-5,8-11,18-24H2,1-3H3,(H,36,39) |
| InChIKey | RWOFRXHVPCEJLO-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|