C32H35N3O4 — CID 46909492
1-[(Z)-4-[[2-cyclopentyl-2-[4-[(6-oxo-3-phenylpyridazin-1-yl)methyl]phenyl]acetyl]amino]but-1-enyl]cyclopropane-1-carboxylic acid (PubChem CID 46909492) has the molecular formula C32H35N3O4 and a molecular weight of 525.65 g/mol. Its IUPAC name is 1-[(Z)-4-[[2-cyclopentyl-2-[4-[(6-oxo-3-phenylpyridazin-1-yl)methyl]phenyl]acetyl]amino]but-1-enyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(Z)-4-[[2-cyclopentyl-2-[4-[(6-oxo-3-phenylpyridazin-1-yl)methyl]phenyl]acetyl]amino]but-1-enyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 46909492 |
| Molecular Formula | C32H35N3O4 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 1-[(Z)-4-[[2-cyclopentyl-2-[4-[(6-oxo-3-phenylpyridazin-1-yl)methyl]phenyl]acetyl]amino]but-1-enyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(NCC/C=C\C1(C(=O)O)CC1)C(c1ccc(Cn2nc(-c3ccccc3)ccc2=O)cc1)C1CCCC1 |
| InChI | InChI=1S/C32H35N3O4/c36-28-17-16-27(24-8-2-1-3-9-24)34-35(28)22-23-12-14-26(15-13-23)29(25-10-4-5-11-25)30(37)33-21-7-6-18-32(19-20-32)31(38)39/h1-3,6,8-9,12-18,25,29H,4-5,7,10-11,19-22H2,(H,33,37)(H,38,39)/b18-6- |
| InChIKey | RIMXYKUAVJLKFS-FXBPXSCXSA-N |
| XLogP | 5.16 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|