C31H37N3O5 — CID 91453678
1-[4-[[2-cyclopentyl-1-hydroxy-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]ethyl]amino]but-1-enyl]cyclopropane-1-carboxylic acid (PubChem CID 91453678) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is 1-[4-[[2-cyclopentyl-1-hydroxy-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]ethyl]amino]but-1-enyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[4-[[2-cyclopentyl-1-hydroxy-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]ethyl]amino]but-1-enyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 91453678 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 1-[4-[[2-cyclopentyl-1-hydroxy-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]ethyl]amino]but-1-enyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C1COC(c2ccccc2)=NN1Cc1ccc(C(C2CCCC2)C(O)NCCC=CC2(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C31H37N3O5/c35-26-21-39-29(25-10-2-1-3-11-25)33-34(26)20-22-12-14-24(15-13-22)27(23-8-4-5-9-23)28(36)32-19-7-6-16-31(17-18-31)30(37)38/h1-3,6,10-16,23,27-28,32,36H,4-5,7-9,17-21H2,(H,37,38) |
| InChIKey | WAAMXPVIJPBVLI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|