C23H34N2O3 — CID 90911572
(10R,13S)-10,13-dimethyl-3-[[(3R)-pyrrolidin-3-yl]oxyamino]-2,5,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione (PubChem CID 90911572) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is (10R,13S)-10,13-dimethyl-3-[[(3R)-pyrrolidin-3-yl]oxyamino]-2,5,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione.
| Compound Name | (10R,13S)-10,13-dimethyl-3-[[(3R)-pyrrolidin-3-yl]oxyamino]-2,5,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
|---|---|
| PubChem CID | 90911572 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | (10R,13S)-10,13-dimethyl-3-[[(3R)-pyrrolidin-3-yl]oxyamino]-2,5,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
| SMILES | C[C@]12CCC(NO[C@@H]3CCNC3)=CC1C(=O)CC1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C23H34N2O3/c1-22-8-5-14(25-28-15-7-10-24-13-15)11-19(22)20(26)12-16-17-3-4-21(27)23(17,2)9-6-18(16)22/h11,15-19,24-25H,3-10,12-13H2,1-2H3/t15-,16?,17?,18?,19?,22-,23+/m1/s1 |
| InChIKey | CCVYEVBYNBDYBF-XWWPAYPQSA-N |
| XLogP | 3.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|