C23H33FN2O3 — CID 123359345
16-fluoro-10,13-dimethyl-3-(pyrrolidin-3-yloxyamino)-2,5,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione (PubChem CID 123359345) has the molecular formula C23H33FN2O3 and a molecular weight of 404.53 g/mol. Its IUPAC name is 16-fluoro-10,13-dimethyl-3-(pyrrolidin-3-yloxyamino)-2,5,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione.
| Compound Name | 16-fluoro-10,13-dimethyl-3-(pyrrolidin-3-yloxyamino)-2,5,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
|---|---|
| PubChem CID | 123359345 |
| Molecular Formula | C23H33FN2O3 |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 16-fluoro-10,13-dimethyl-3-(pyrrolidin-3-yloxyamino)-2,5,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
| SMILES | CC12CCC3C(CC(=O)C4C=C(NOC5CCNC5)CCC43C)C1CC(F)C2=O |
| InChI | InChI=1S/C23H33FN2O3/c1-22-6-3-13(26-29-14-5-8-25-12-14)9-18(22)20(27)10-15-16(22)4-7-23(2)17(15)11-19(24)21(23)28/h9,14-19,25-26H,3-8,10-12H2,1-2H3 |
| InChIKey | WXZUJGVYKFSADW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|