C27H23F4N4O2+ — CID 90912717
5-[[4-[2,4-bis(1,1-difluoroethyl)phenyl]furan-2-yl]methyl]-2-(2-methoxyphenyl)-3H-imidazo[4,5-d]pyridazin-5-ium (PubChem CID 90912717) has the molecular formula C27H23F4N4O2+ and a molecular weight of 511.50 g/mol. Its IUPAC name is 5-[[4-[2,4-bis(1,1-difluoroethyl)phenyl]furan-2-yl]methyl]-2-(2-methoxyphenyl)-3H-imidazo[4,5-d]pyridazin-5-ium.
| Compound Name | 5-[[4-[2,4-bis(1,1-difluoroethyl)phenyl]furan-2-yl]methyl]-2-(2-methoxyphenyl)-3H-imidazo[4,5-d]pyridazin-5-ium |
|---|---|
| PubChem CID | 90912717 |
| Molecular Formula | C27H23F4N4O2+ |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 5-[[4-[2,4-bis(1,1-difluoroethyl)phenyl]furan-2-yl]methyl]-2-(2-methoxyphenyl)-3H-imidazo[4,5-d]pyridazin-5-ium |
| SMILES | COc1ccccc1-c1nc2cn[n+](Cc3cc(-c4ccc(C(C)(F)F)cc4C(C)(F)F)co3)cc2[nH]1 |
| InChI | InChI=1S/C27H22F4N4O2/c1-26(28,29)17-8-9-19(21(11-17)27(2,30)31)16-10-18(37-15-16)13-35-14-23-22(12-32-35)33-25(34-23)20-6-4-5-7-24(20)36-3/h4-12,14-15H,13H2,1-3H3/p+1 |
| InChIKey | UETBZJBENBLVCW-UHFFFAOYSA-O |
| XLogP | 6.45 |
| TPSA | 67.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|