C16H25F4NO3S — CID 90913053
ethane;3-(2-ethylphenyl)-2,2,3,3-tetrafluoro-N-methylsulfonylpropanamide (PubChem CID 90913053) has the molecular formula C16H25F4NO3S and a molecular weight of 387.44 g/mol. Its IUPAC name is ethane;3-(2-ethylphenyl)-2,2,3,3-tetrafluoro-N-methylsulfonylpropanamide.
| Compound Name | ethane;3-(2-ethylphenyl)-2,2,3,3-tetrafluoro-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 90913053 |
| Molecular Formula | C16H25F4NO3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | ethane;3-(2-ethylphenyl)-2,2,3,3-tetrafluoro-N-methylsulfonylpropanamide |
| SMILES | CC.CC.CCc1ccccc1C(F)(F)C(F)(F)C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C12H13F4NO3S.2C2H6/c1-3-8-6-4-5-7-9(8)11(13,14)12(15,16)10(18)17-21(2,19)20;2*1-2/h4-7H,3H2,1-2H3,(H,17,18);2*1-2H3 |
| InChIKey | DGUOYVNNLYJMBM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|