C33H40N4O — CID 90913583
2-[[1-cyclopentyl-4-[4-(3-isocyanophenyl)phenyl]piperidin-4-yl]amino]-N-phenylacetamide;ethane (PubChem CID 90913583) has the molecular formula C33H40N4O and a molecular weight of 508.71 g/mol. Its IUPAC name is 2-[[1-cyclopentyl-4-[4-(3-isocyanophenyl)phenyl]piperidin-4-yl]amino]-N-phenylacetamide;ethane.
| Compound Name | 2-[[1-cyclopentyl-4-[4-(3-isocyanophenyl)phenyl]piperidin-4-yl]amino]-N-phenylacetamide;ethane |
|---|---|
| PubChem CID | 90913583 |
| Molecular Formula | C33H40N4O |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | 2-[[1-cyclopentyl-4-[4-(3-isocyanophenyl)phenyl]piperidin-4-yl]amino]-N-phenylacetamide;ethane |
| SMILES | CC.[C-]#[N+]c1cccc(-c2ccc(C3(NCC(=O)Nc4ccccc4)CCN(C4CCCC4)CC3)cc2)c1 |
| InChI | InChI=1S/C31H34N4O.C2H6/c1-32-28-11-7-8-25(22-28)24-14-16-26(17-15-24)31(18-20-35(21-19-31)29-12-5-6-13-29)33-23-30(36)34-27-9-3-2-4-10-27;1-2/h2-4,7-11,14-17,22,29,33H,5-6,12-13,18-21,23H2,(H,34,36);1-2H3 |
| InChIKey | AXKFLHXEUIAUEK-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 48.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|