C31H31Cl2N3O4 — CID 20609031
tert-butyl 4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-4-[4-(3-isocyanophenyl)phenyl]piperidine-1-carboxylate (PubChem CID 20609031) has the molecular formula C31H31Cl2N3O4 and a molecular weight of 580.51 g/mol. Its IUPAC name is tert-butyl 4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-4-[4-(3-isocyanophenyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-4-[4-(3-isocyanophenyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 20609031 |
| Molecular Formula | C31H31Cl2N3O4 |
| Molecular Weight | 580.51 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | tert-butyl 4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-4-[4-(3-isocyanophenyl)phenyl]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1cccc(-c2ccc(C3(OCC(=O)Nc4cc(Cl)cc(Cl)c4)CCN(C(=O)OC(C)(C)C)CC3)cc2)c1 |
| InChI | InChI=1S/C31H31Cl2N3O4/c1-30(2,3)40-29(38)36-14-12-31(13-15-36,39-20-28(37)35-27-18-24(32)17-25(33)19-27)23-10-8-21(9-11-23)22-6-5-7-26(16-22)34-4/h5-11,16-19H,12-15,20H2,1-3H3,(H,35,37) |
| InChIKey | CBIWOQABQHPDRP-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.51 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|