C30H29Cl2N3O2 — CID 20608944
2-[1-(cyclopropylmethyl)-4-[4-(3-isocyanophenyl)phenyl]piperidin-4-yl]oxy-N-(3,5-dichlorophenyl)acetamide (PubChem CID 20608944) has the molecular formula C30H29Cl2N3O2 and a molecular weight of 534.49 g/mol. Its IUPAC name is 2-[1-(cyclopropylmethyl)-4-[4-(3-isocyanophenyl)phenyl]piperidin-4-yl]oxy-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2-[1-(cyclopropylmethyl)-4-[4-(3-isocyanophenyl)phenyl]piperidin-4-yl]oxy-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 20608944 |
| Molecular Formula | C30H29Cl2N3O2 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 2-[1-(cyclopropylmethyl)-4-[4-(3-isocyanophenyl)phenyl]piperidin-4-yl]oxy-N-(3,5-dichlorophenyl)acetamide |
| SMILES | [C-]#[N+]c1cccc(-c2ccc(C3(OCC(=O)Nc4cc(Cl)cc(Cl)c4)CCN(CC4CC4)CC3)cc2)c1 |
| InChI | InChI=1S/C30H29Cl2N3O2/c1-33-27-4-2-3-23(15-27)22-7-9-24(10-8-22)30(11-13-35(14-12-30)19-21-5-6-21)37-20-29(36)34-28-17-25(31)16-26(32)18-28/h2-4,7-10,15-18,21H,5-6,11-14,19-20H2,(H,34,36) |
| InChIKey | DPVHVWIMUBSBAX-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|