C25H30Cl2IN3O3 — CID 68534877
tert-butyl 4-[[(3,5-dichlorophenyl)carbamoyl-methylamino]methyl]-4-(4-iodophenyl)piperidine-1-carboxylate (PubChem CID 68534877) has the molecular formula C25H30Cl2IN3O3 and a molecular weight of 618.34 g/mol. Its IUPAC name is tert-butyl 4-[[(3,5-dichlorophenyl)carbamoyl-methylamino]methyl]-4-(4-iodophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(3,5-dichlorophenyl)carbamoyl-methylamino]methyl]-4-(4-iodophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68534877 |
| Molecular Formula | C25H30Cl2IN3O3 |
| Molecular Weight | 618.34 g/mol |
| Exact Mass | 617.07 |
| IUPAC Name | tert-butyl 4-[[(3,5-dichlorophenyl)carbamoyl-methylamino]methyl]-4-(4-iodophenyl)piperidine-1-carboxylate |
| SMILES | CN(CC1(c2ccc(I)cc2)CCN(C(=O)OC(C)(C)C)CC1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C25H30Cl2IN3O3/c1-24(2,3)34-23(33)31-11-9-25(10-12-31,17-5-7-20(28)8-6-17)16-30(4)22(32)29-21-14-18(26)13-19(27)15-21/h5-8,13-15H,9-12,16H2,1-4H3,(H,29,32) |
| InChIKey | CTPGWFYPSBXXGQ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.34 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|