C26H33BClNO5 — CID 90914164
4-benzyl-3-[2-[3-chloro-4-[ethoxy(2-methylpentan-3-yloxy)boranyl]phenyl]acetyl]-1,3-oxazolidin-2-one (PubChem CID 90914164) has the molecular formula C26H33BClNO5 and a molecular weight of 485.82 g/mol. Its IUPAC name is 4-benzyl-3-[2-[3-chloro-4-[ethoxy(2-methylpentan-3-yloxy)boranyl]phenyl]acetyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[2-[3-chloro-4-[ethoxy(2-methylpentan-3-yloxy)boranyl]phenyl]acetyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90914164 |
| Molecular Formula | C26H33BClNO5 |
| Molecular Weight | 485.82 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 4-benzyl-3-[2-[3-chloro-4-[ethoxy(2-methylpentan-3-yloxy)boranyl]phenyl]acetyl]-1,3-oxazolidin-2-one |
| SMILES | CCOB(OC(CC)C(C)C)c1ccc(CC(=O)N2C(=O)OCC2Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C26H33BClNO5/c1-5-24(18(3)4)34-27(33-6-2)22-13-12-20(15-23(22)28)16-25(30)29-21(17-32-26(29)31)14-19-10-8-7-9-11-19/h7-13,15,18,21,24H,5-6,14,16-17H2,1-4H3 |
| InChIKey | VGWKYRJCXUJLQV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|