About methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate
methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate (PubChem CID 90914408) has the molecular formula C16H26N2O3
and a molecular weight of 294.40 g/mol. Its IUPAC name is methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate |
| PubChem CID | 90914408 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)N(C)c1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C16H26N2O3/c1-10(2)8-13(16(19)21-7)18(5)15-12(4)14(20-6)11(3)9-17-15/h9-10,13H,8H2,1-7H3/t13-/m1/s1 |
| InChIKey | UAVAODCKVMNWBF-CYBMUJFWSA-N |
| XLogP | 2.73 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate?
The IUPAC name of methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate (CID 90914408) is methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate.
What is the SMILES notation for methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate?
The canonical SMILES for methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate is COC(=O)[C@@H](CC(C)C)N(C)c1ncc(C)c(OC)c1C.
What is the InChIKey of methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate?
The InChIKey is UAVAODCKVMNWBF-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H26N2O3/c1-10(2)8-13(16(19)21-7)18(5)15-12(4)14(20-6)11(3)9-17-15/h9-10,13H,8H2,1-7H3/t13-/m1/s1.
What are the key properties of methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate?
methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate has a molecular weight of 294.40 g/mol, XLogP of 2.73, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)-methylamino]-4-methylpentanoate is sourced from PubChem (CID 90914408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).