C14H18N2O3S — CID 90914504
4-(benzenesulfonyl)-5-pentyl-1,2-dihydropyrazol-3-one (PubChem CID 90914504) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-pentyl-1,2-dihydropyrazol-3-one.
| Compound Name | 4-(benzenesulfonyl)-5-pentyl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 90914504 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(benzenesulfonyl)-5-pentyl-1,2-dihydropyrazol-3-one |
| SMILES | CCCCCc1[nH][nH]c(=O)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18N2O3S/c1-2-3-5-10-12-13(14(17)16-15-12)20(18,19)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3,(H2,15,16,17) |
| InChIKey | MADRHHGRTPNPEL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|