C11H12N2O3S — CID 12962406
4-(benzenesulfonyl)-2,5-dimethyl-1H-pyrazol-3-one (PubChem CID 12962406) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2,5-dimethyl-1H-pyrazol-3-one.
| Compound Name | 4-(benzenesulfonyl)-2,5-dimethyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 12962406 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 4-(benzenesulfonyl)-2,5-dimethyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(C)c(=O)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12N2O3S/c1-8-10(11(14)13(2)12-8)17(15,16)9-6-4-3-5-7-9/h3-7,12H,1-2H3 |
| InChIKey | YCWAHFPGGFKXJZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |