C12H13N3O3S3 — CID 753520
N'-(benzenesulfonyl)-3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide (PubChem CID 753520) has the molecular formula C12H13N3O3S3 and a molecular weight of 343.46 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(benzenesulfonyl)-3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 753520 |
| Molecular Formula | C12H13N3O3S3 |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | N'-(benzenesulfonyl)-3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1c(C(=O)NNS(=O)(=O)c2ccccc2)sc(=S)n1C |
| InChI | InChI=1S/C12H13N3O3S3/c1-8-10(20-12(19)15(8)2)11(16)13-14-21(17,18)9-6-4-3-5-7-9/h3-7,14H,1-2H3,(H,13,16) |
| InChIKey | WRFHUWVYAILZGR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|