C13H15N3O3S3 — CID 5123267
3,4-dimethyl-N'-(4-methylphenyl)sulfonyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide (PubChem CID 5123267) has the molecular formula C13H15N3O3S3 and a molecular weight of 357.48 g/mol. Its IUPAC name is 3,4-dimethyl-N'-(4-methylphenyl)sulfonyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide.
| Compound Name | 3,4-dimethyl-N'-(4-methylphenyl)sulfonyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 5123267 |
| Molecular Formula | C13H15N3O3S3 |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 3,4-dimethyl-N'-(4-methylphenyl)sulfonyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)c2sc(=S)n(C)c2C)cc1 |
| InChI | InChI=1S/C13H15N3O3S3/c1-8-4-6-10(7-5-8)22(18,19)15-14-12(17)11-9(2)16(3)13(20)21-11/h4-7,15H,1-3H3,(H,14,17) |
| InChIKey | KYFWKGXRQWVKNJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|