C11H12N2O3S — CID 97032779
5-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one (PubChem CID 97032779) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is 5-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 97032779 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 5-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydropyrazol-3-one |
| SMILES | Cc1ccc(S(=O)(=O)Cc2cc(=O)[nH][nH]2)cc1 |
| InChI | InChI=1S/C11H12N2O3S/c1-8-2-4-10(5-3-8)17(15,16)7-9-6-11(14)13-12-9/h2-6H,7H2,1H3,(H2,12,13,14) |
| InChIKey | VMTPNIBADKXAMO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |