C11H14N2O — CID 90915117
2-(3,4-dihydropyrazol-2-yl)-1-phenylethanol (PubChem CID 90915117) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-(3,4-dihydropyrazol-2-yl)-1-phenylethanol.
| Compound Name | 2-(3,4-dihydropyrazol-2-yl)-1-phenylethanol |
|---|---|
| PubChem CID | 90915117 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-(3,4-dihydropyrazol-2-yl)-1-phenylethanol |
| SMILES | OC(CN1CCC=N1)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O/c14-11(9-13-8-4-7-12-13)10-5-2-1-3-6-10/h1-3,5-7,11,14H,4,8-9H2 |
| InChIKey | YYBCVNMAGAPSON-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |