C32H27F3O7S — CID 90916256
[2-[5-methoxy-2-(4-methylsulfonylphenyl)phenyl]acetyl] 2-[5-methoxy-2-[4-(trifluoromethyl)phenyl]phenyl]acetate (PubChem CID 90916256) has the molecular formula C32H27F3O7S and a molecular weight of 612.62 g/mol. Its IUPAC name is [2-[5-methoxy-2-(4-methylsulfonylphenyl)phenyl]acetyl] 2-[5-methoxy-2-[4-(trifluoromethyl)phenyl]phenyl]acetate.
| Compound Name | [2-[5-methoxy-2-(4-methylsulfonylphenyl)phenyl]acetyl] 2-[5-methoxy-2-[4-(trifluoromethyl)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 90916256 |
| Molecular Formula | C32H27F3O7S |
| Molecular Weight | 612.62 g/mol |
| Exact Mass | 612.14 |
| IUPAC Name | [2-[5-methoxy-2-(4-methylsulfonylphenyl)phenyl]acetyl] 2-[5-methoxy-2-[4-(trifluoromethyl)phenyl]phenyl]acetate |
| SMILES | COc1ccc(-c2ccc(C(F)(F)F)cc2)c(CC(=O)OC(=O)Cc2cc(OC)ccc2-c2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C32H27F3O7S/c1-40-25-10-14-28(20-4-8-24(9-5-20)32(33,34)35)22(16-25)18-30(36)42-31(37)19-23-17-26(41-2)11-15-29(23)21-6-12-27(13-7-21)43(3,38)39/h4-17H,18-19H2,1-3H3 |
| InChIKey | ARQADMDAEGLNMK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|