C22H24N2OS — CID 90916998
5-[(4-tert-butylphenyl)methylsulfanyl]-3-methyl-1-phenylpyrazole-4-carbaldehyde (PubChem CID 90916998) has the molecular formula C22H24N2OS and a molecular weight of 364.51 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)methylsulfanyl]-3-methyl-1-phenylpyrazole-4-carbaldehyde.
| Compound Name | 5-[(4-tert-butylphenyl)methylsulfanyl]-3-methyl-1-phenylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 90916998 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 5-[(4-tert-butylphenyl)methylsulfanyl]-3-methyl-1-phenylpyrazole-4-carbaldehyde |
| SMILES | Cc1nn(-c2ccccc2)c(SCc2ccc(C(C)(C)C)cc2)c1C=O |
| InChI | InChI=1S/C22H24N2OS/c1-16-20(14-25)21(24(23-16)19-8-6-5-7-9-19)26-15-17-10-12-18(13-11-17)22(2,3)4/h5-14H,15H2,1-4H3 |
| InChIKey | QYLYLZGLHOJMOX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|