C19H21F3N2O2S — CID 170872259
(E)-3-[5-[(4-tert-butylphenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoic acid (PubChem CID 170872259) has the molecular formula C19H21F3N2O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is (E)-3-[5-[(4-tert-butylphenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(4-tert-butylphenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170872259 |
| Molecular Formula | C19H21F3N2O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (E)-3-[5-[(4-tert-butylphenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cn1nc(C(F)(F)F)c(/C=C/C(=O)O)c1SCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H21F3N2O2S/c1-18(2,3)13-7-5-12(6-8-13)11-27-17-14(9-10-15(25)26)16(19(20,21)22)23-24(17)4/h5-10H,11H2,1-4H3,(H,25,26)/b10-9+ |
| InChIKey | OWWCLGXISPKUQM-MDZDMXLPSA-N |
| XLogP | 5.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|