C13H9Cl2F3N2OS — CID 87821423
5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride (PubChem CID 87821423) has the molecular formula C13H9Cl2F3N2OS and a molecular weight of 369.20 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride.
| Compound Name | 5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 87821423 |
| Molecular Formula | C13H9Cl2F3N2OS |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
| SMILES | Cn1nc(C(F)(F)F)c(C(=O)Cl)c1SCc1ccccc1Cl |
| InChI | InChI=1S/C13H9Cl2F3N2OS/c1-20-12(22-6-7-4-2-3-5-8(7)14)9(11(15)21)10(19-20)13(16,17)18/h2-5H,6H2,1H3 |
| InChIKey | BWFCGOIVGIMTPK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|