C23H15Cl2F3N4O2S2 — CID 91038086
1-(4-chlorophenyl)-5-[[5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91038086) has the molecular formula C23H15Cl2F3N4O2S2 and a molecular weight of 571.43 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[[5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(4-chlorophenyl)-5-[[5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91038086 |
| Molecular Formula | C23H15Cl2F3N4O2S2 |
| Molecular Weight | 571.43 g/mol |
| Exact Mass | 570.00 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[[5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cn1nc(C(F)(F)F)c(C=C2C(=O)NC(=S)N(c3ccc(Cl)cc3)C2=O)c1SCc1ccccc1Cl |
| InChI | InChI=1S/C23H15Cl2F3N4O2S2/c1-31-21(36-11-12-4-2-3-5-17(12)25)15(18(30-31)23(26,27)28)10-16-19(33)29-22(35)32(20(16)34)14-8-6-13(24)7-9-14/h2-10H,11H2,1H3,(H,29,33,35) |
| InChIKey | BFSYQFLQRKPLJG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|