C26H17ClFN3O3S — CID 91410607
1-(4-chlorophenyl)-5-[[2-(4-fluorophenoxy)-1-methylindol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91410607) has the molecular formula C26H17ClFN3O3S and a molecular weight of 505.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[[2-(4-fluorophenoxy)-1-methylindol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(4-chlorophenyl)-5-[[2-(4-fluorophenoxy)-1-methylindol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91410607 |
| Molecular Formula | C26H17ClFN3O3S |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[[2-(4-fluorophenoxy)-1-methylindol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cn1c(Oc2ccc(F)cc2)c(C=C2C(=O)NC(=S)N(c3ccc(Cl)cc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C26H17ClFN3O3S/c1-30-22-5-3-2-4-19(22)20(25(30)34-18-12-8-16(28)9-13-18)14-21-23(32)29-26(35)31(24(21)33)17-10-6-15(27)7-11-17/h2-14H,1H3,(H,29,32,35) |
| InChIKey | MOLONAOJYZWEPZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|