C33H25N3O4S — CID 90884588
5-[[1-methyl-2-(4-methylphenoxy)indol-3-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90884588) has the molecular formula C33H25N3O4S and a molecular weight of 559.65 g/mol. Its IUPAC name is 5-[[1-methyl-2-(4-methylphenoxy)indol-3-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[1-methyl-2-(4-methylphenoxy)indol-3-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90884588 |
| Molecular Formula | C33H25N3O4S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 5-[[1-methyl-2-(4-methylphenoxy)indol-3-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(Oc2c(C=C3C(=O)NC(=S)N(c4ccc(Oc5ccccc5)cc4)C3=O)c3ccccc3n2C)cc1 |
| InChI | InChI=1S/C33H25N3O4S/c1-21-12-16-25(17-13-21)40-32-27(26-10-6-7-11-29(26)35(32)2)20-28-30(37)34-33(41)36(31(28)38)22-14-18-24(19-15-22)39-23-8-4-3-5-9-23/h3-20H,1-2H3,(H,34,37,41) |
| InChIKey | CURLKZBADNCCNX-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|