C32H22ClN5O6S — CID 90912863
5-chloro-6-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 90912863) has the molecular formula C32H22ClN5O6S and a molecular weight of 640.08 g/mol. Its IUPAC name is 5-chloro-6-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-chloro-6-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 90912863 |
| Molecular Formula | C32H22ClN5O6S |
| Molecular Weight | 640.08 g/mol |
| Exact Mass | 639.10 |
| IUPAC Name | 5-chloro-6-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)c2c(Cl)c(C=C3C(=O)NC(=S)N(c4ccc(Oc5ccccc5)cc4)C3=O)c(=O)n(-c3ccccc3)c2n(C)c1=O |
| InChI | InChI=1S/C32H22ClN5O6S/c1-35-27-24(30(42)36(2)32(35)43)25(33)22(28(40)37(27)18-9-5-3-6-10-18)17-23-26(39)34-31(45)38(29(23)41)19-13-15-21(16-14-19)44-20-11-7-4-8-12-20/h3-17H,1-2H3,(H,34,39,45) |
| InChIKey | JQJFSKAEMCKZLX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.08 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|