C25H25ClN4S — CID 169261988
3-[(4-tert-butylphenyl)methylsulfanyl]-6-chloro-2-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)pyridine (PubChem CID 169261988) has the molecular formula C25H25ClN4S and a molecular weight of 449.02 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methylsulfanyl]-6-chloro-2-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 3-[(4-tert-butylphenyl)methylsulfanyl]-6-chloro-2-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 169261988 |
| Molecular Formula | C25H25ClN4S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methylsulfanyl]-6-chloro-2-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)pyridine |
| SMILES | Cn1nc(-c2ccccc2)nc1-c1nc(Cl)ccc1SCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H25ClN4S/c1-25(2,3)19-12-10-17(11-13-19)16-31-20-14-15-21(26)27-22(20)24-28-23(29-30(24)4)18-8-6-5-7-9-18/h5-15H,16H2,1-4H3 |
| InChIKey | JDUYCAWXHJEDLC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|