C18H18ClF3N2O2 — CID 92908945
(4-tert-butylphenyl) (Z)-3-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoate (PubChem CID 92908945) has the molecular formula C18H18ClF3N2O2 and a molecular weight of 386.80 g/mol. Its IUPAC name is (4-tert-butylphenyl) (Z)-3-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoate.
| Compound Name | (4-tert-butylphenyl) (Z)-3-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 92908945 |
| Molecular Formula | C18H18ClF3N2O2 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (4-tert-butylphenyl) (Z)-3-[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enoate |
| SMILES | Cn1nc(C(F)(F)F)c(/C=C\C(=O)Oc2ccc(C(C)(C)C)cc2)c1Cl |
| InChI | InChI=1S/C18H18ClF3N2O2/c1-17(2,3)11-5-7-12(8-6-11)26-14(25)10-9-13-15(18(20,21)22)23-24(4)16(13)19/h5-10H,1-4H3/b10-9- |
| InChIKey | OOSPWZQDLUQENI-KTKRTIGZSA-N |
| XLogP | 5.01 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|