C15H21N3 — CID 90917557
2-[1-(1,4-diazepan-1-yl)ethyl]-1H-indole (PubChem CID 90917557) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[1-(1,4-diazepan-1-yl)ethyl]-1H-indole.
| Compound Name | 2-[1-(1,4-diazepan-1-yl)ethyl]-1H-indole |
|---|---|
| PubChem CID | 90917557 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-[1-(1,4-diazepan-1-yl)ethyl]-1H-indole |
| SMILES | CC(c1cc2ccccc2[nH]1)N1CCCNCC1 |
| InChI | InChI=1S/C15H21N3/c1-12(18-9-4-7-16-8-10-18)15-11-13-5-2-3-6-14(13)17-15/h2-3,5-6,11-12,16-17H,4,7-10H2,1H3 |
| InChIKey | RLISNMQMEQQCOS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |