C46H42N8O4+2 — CID 90918477
methyl 4-[10,20-bis(1,3-dimethylimidazol-1-ium-2-yl)-15-(4-methoxycarbonylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzoate (PubChem CID 90918477) has the molecular formula C46H42N8O4+2 and a molecular weight of 770.89 g/mol. Its IUPAC name is methyl 4-[10,20-bis(1,3-dimethylimidazol-1-ium-2-yl)-15-(4-methoxycarbonylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[10,20-bis(1,3-dimethylimidazol-1-ium-2-yl)-15-(4-methoxycarbonylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 90918477 |
| Molecular Formula | C46H42N8O4+2 |
| Molecular Weight | 770.89 g/mol |
| Exact Mass | 770.33 |
| IUPAC Name | methyl 4-[10,20-bis(1,3-dimethylimidazol-1-ium-2-yl)-15-(4-methoxycarbonylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2=c3ccc([nH]3)=C(c3n(C)cc[n+]3C)c3ccc([nH]3)C(c3ccc(C(=O)OC)cc3)=c3ccc([nH]3)=C(c3n(C)cc[n+]3C)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C46H40N8O4/c1-51-23-24-52(2)43(51)41-35-19-15-31(47-35)39(27-7-11-29(12-8-27)45(55)57-5)33-17-21-37(49-33)42(44-53(3)25-26-54(44)4)38-22-18-34(50-38)40(32-16-20-36(41)48-32)28-9-13-30(14-10-28)46(56)58-6/h7-26H,1-6H3,(H2,47,48,49,50)/p+2 |
| InChIKey | OEPIFAZRBWIMMA-UHFFFAOYSA-P |
| XLogP | 2.20 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.89 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|