C33H28N2O4S — CID 90919725
7-(4-methylpentyl)-18-(3-sulfanylpropyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 90919725) has the molecular formula C33H28N2O4S and a molecular weight of 548.66 g/mol. Its IUPAC name is 7-(4-methylpentyl)-18-(3-sulfanylpropyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 7-(4-methylpentyl)-18-(3-sulfanylpropyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 90919725 |
| Molecular Formula | C33H28N2O4S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 7-(4-methylpentyl)-18-(3-sulfanylpropyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | CC(C)CCCN1C(=O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C1=O)c64)C(=O)N(CCCS)C5=O |
| InChI | InChI=1S/C33H28N2O4S/c1-17(2)5-3-14-34-30(36)22-10-6-18-20-8-12-24-29-25(33(39)35(32(24)38)15-4-16-40)13-9-21(27(20)29)19-7-11-23(31(34)37)28(22)26(18)19/h6-13,17,40H,3-5,14-16H2,1-2H3 |
| InChIKey | JLFGLSISMMQPEN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|