C9H19N3 — CID 90919791
ethane;(E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine (PubChem CID 90919791) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is ethane;(E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine.
| Compound Name | ethane;(E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine |
|---|---|
| PubChem CID | 90919791 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | ethane;(E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine |
| SMILES | CC.[H]/N=C/C(=C\C=N\C)N(C)C |
| InChI | InChI=1S/C7H13N3.C2H6/c1-9-5-4-7(6-8)10(2)3;1-2/h4-6,8H,1-3H3;1-2H3/b7-4+,8-6+,9-5+; |
| InChIKey | WWHGHYNTBALFFF-UNFJGJJFSA-N |
| XLogP | 1.81 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|