C30H40N4O6 — CID 90920220
2-amino-N-[(7,18-diethoxy-5,8,19-trihydroxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),16,18-heptaen-10-yl)methyl]propanamide (PubChem CID 90920220) has the molecular formula C30H40N4O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is 2-amino-N-[(7,18-diethoxy-5,8,19-trihydroxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),16,18-heptaen-10-yl)methyl]propanamide.
| Compound Name | 2-amino-N-[(7,18-diethoxy-5,8,19-trihydroxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),16,18-heptaen-10-yl)methyl]propanamide |
|---|---|
| PubChem CID | 90920220 |
| Molecular Formula | C30H40N4O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 2-amino-N-[(7,18-diethoxy-5,8,19-trihydroxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),16,18-heptaen-10-yl)methyl]propanamide |
| SMILES | CCOc1c(C)cc2c(c1O)C1C3=Cc4c(O)c(C)c(OCC)c(O)c4C(CNC(=O)C(C)N)N3CC(C2)N1C |
| InChI | InChI=1S/C30H40N4O6/c1-7-39-28-14(3)9-17-10-18-13-34-20(24(33(18)6)22(17)26(28)36)11-19-23(21(34)12-32-30(38)16(5)31)27(37)29(40-8-2)15(4)25(19)35/h9,11,16,18,21,24,35-37H,7-8,10,12-13,31H2,1-6H3,(H,32,38) |
| InChIKey | POUVBSNOUHHSOO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|