C21H19F3N2O6 — CID 90920597
3-methyl-1-(4-nitrophenoxy)carbonyl-5-[4-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid (PubChem CID 90920597) has the molecular formula C21H19F3N2O6 and a molecular weight of 452.39 g/mol. Its IUPAC name is 3-methyl-1-(4-nitrophenoxy)carbonyl-5-[4-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-(4-nitrophenoxy)carbonyl-5-[4-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 90920597 |
| Molecular Formula | C21H19F3N2O6 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 3-methyl-1-(4-nitrophenoxy)carbonyl-5-[4-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CC(c2ccc(C(F)(F)F)cc2)CN(C(=O)Oc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C21H19F3N2O6/c1-20(18(27)28)10-14(13-2-4-15(5-3-13)21(22,23)24)11-25(12-20)19(29)32-17-8-6-16(7-9-17)26(30)31/h2-9,14H,10-12H2,1H3,(H,27,28) |
| InChIKey | WPZCHMLUIVAAMS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|