C22H20F4N2O6 — CID 58116542
3-O-methyl 1-O-(4-nitrophenyl) 5-[3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]piperidine-1,3-dicarboxylate (PubChem CID 58116542) has the molecular formula C22H20F4N2O6 and a molecular weight of 484.40 g/mol. Its IUPAC name is 3-O-methyl 1-O-(4-nitrophenyl) 5-[3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]piperidine-1,3-dicarboxylate.
| Compound Name | 3-O-methyl 1-O-(4-nitrophenyl) 5-[3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 58116542 |
| Molecular Formula | C22H20F4N2O6 |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 3-O-methyl 1-O-(4-nitrophenyl) 5-[3-fluoro-4-(2,2,2-trifluoroethyl)phenyl]piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1CC(c2ccc(CC(F)(F)F)c(F)c2)CN(C(=O)Oc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C22H20F4N2O6/c1-33-20(29)16-8-15(13-2-3-14(19(23)9-13)10-22(24,25)26)11-27(12-16)21(30)34-18-6-4-17(5-7-18)28(31)32/h2-7,9,15-16H,8,10-12H2,1H3 |
| InChIKey | YWMFOXSCJUNNCZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|