C21H17F2N3O8 — CID 57046517
1-O-methyl 3-O-(4-nitrophenyl) 4-(3,4-difluorophenyl)-6-(methoxymethyl)-2-oxo-4H-pyrimidine-1,3-dicarboxylate (PubChem CID 57046517) has the molecular formula C21H17F2N3O8 and a molecular weight of 477.38 g/mol. Its IUPAC name is 1-O-methyl 3-O-(4-nitrophenyl) 4-(3,4-difluorophenyl)-6-(methoxymethyl)-2-oxo-4H-pyrimidine-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-(4-nitrophenyl) 4-(3,4-difluorophenyl)-6-(methoxymethyl)-2-oxo-4H-pyrimidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 57046517 |
| Molecular Formula | C21H17F2N3O8 |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 1-O-methyl 3-O-(4-nitrophenyl) 4-(3,4-difluorophenyl)-6-(methoxymethyl)-2-oxo-4H-pyrimidine-1,3-dicarboxylate |
| SMILES | COCC1=CC(c2ccc(F)c(F)c2)N(C(=O)Oc2ccc([N+](=O)[O-])cc2)C(=O)N1C(=O)OC |
| InChI | InChI=1S/C21H17F2N3O8/c1-32-11-14-10-18(12-3-8-16(22)17(23)9-12)25(19(27)24(14)20(28)33-2)21(29)34-15-6-4-13(5-7-15)26(30)31/h3-10,18H,11H2,1-2H3 |
| InChIKey | OGMWTBRSUGHJCI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|