C22H21F2N3O7 — CID 20612446
4-(3,4-difluorophenyl)-6-(methoxymethyl)-5-(methylperoxymethyl)-3-[2-(4-nitrophenyl)acetyl]-1,4-dihydropyrimidin-2-one (PubChem CID 20612446) has the molecular formula C22H21F2N3O7 and a molecular weight of 477.42 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-6-(methoxymethyl)-5-(methylperoxymethyl)-3-[2-(4-nitrophenyl)acetyl]-1,4-dihydropyrimidin-2-one.
| Compound Name | 4-(3,4-difluorophenyl)-6-(methoxymethyl)-5-(methylperoxymethyl)-3-[2-(4-nitrophenyl)acetyl]-1,4-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 20612446 |
| Molecular Formula | C22H21F2N3O7 |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 4-(3,4-difluorophenyl)-6-(methoxymethyl)-5-(methylperoxymethyl)-3-[2-(4-nitrophenyl)acetyl]-1,4-dihydropyrimidin-2-one |
| SMILES | COCC1=C(COOC)C(c2ccc(F)c(F)c2)N(C(=O)Cc2ccc([N+](=O)[O-])cc2)C(=O)N1 |
| InChI | InChI=1S/C22H21F2N3O7/c1-32-12-19-16(11-34-33-2)21(14-5-8-17(23)18(24)10-14)26(22(29)25-19)20(28)9-13-3-6-15(7-4-13)27(30)31/h3-8,10,21H,9,11-12H2,1-2H3,(H,25,29) |
| InChIKey | LZBLYCGDWPGLBS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|