C18H14F2N2O7 — CID 70243644
(4-nitrophenyl) (4S,5R)-4-(3,4-difluorophenyl)-5-(methoxymethyl)-2-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 70243644) has the molecular formula C18H14F2N2O7 and a molecular weight of 408.31 g/mol. Its IUPAC name is (4-nitrophenyl) (4S,5R)-4-(3,4-difluorophenyl)-5-(methoxymethyl)-2-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | (4-nitrophenyl) (4S,5R)-4-(3,4-difluorophenyl)-5-(methoxymethyl)-2-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 70243644 |
| Molecular Formula | C18H14F2N2O7 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (4-nitrophenyl) (4S,5R)-4-(3,4-difluorophenyl)-5-(methoxymethyl)-2-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | COC[C@@H]1OC(=O)N(C(=O)Oc2ccc([N+](=O)[O-])cc2)[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H14F2N2O7/c1-27-9-15-16(10-2-7-13(19)14(20)8-10)21(18(24)29-15)17(23)28-12-5-3-11(4-6-12)22(25)26/h2-8,15-16H,9H2,1H3/t15-,16-/m0/s1 |
| InChIKey | CNWRCCHJMCSGNN-HOTGVXAUSA-N |
| XLogP | 3.58 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|