C25H25F2N3O8Si — CID 57146825
5-O-methyl 1-O-(4-nitrophenyl) 6-(3,4-difluorophenyl)-4-(1-hydroxy-3-trimethylsilylpropyl)-2-oxopyrimidine-1,5-dicarboxylate (PubChem CID 57146825) has the molecular formula C25H25F2N3O8Si and a molecular weight of 561.57 g/mol. Its IUPAC name is 5-O-methyl 1-O-(4-nitrophenyl) 6-(3,4-difluorophenyl)-4-(1-hydroxy-3-trimethylsilylpropyl)-2-oxopyrimidine-1,5-dicarboxylate.
| Compound Name | 5-O-methyl 1-O-(4-nitrophenyl) 6-(3,4-difluorophenyl)-4-(1-hydroxy-3-trimethylsilylpropyl)-2-oxopyrimidine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 57146825 |
| Molecular Formula | C25H25F2N3O8Si |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | 5-O-methyl 1-O-(4-nitrophenyl) 6-(3,4-difluorophenyl)-4-(1-hydroxy-3-trimethylsilylpropyl)-2-oxopyrimidine-1,5-dicarboxylate |
| SMILES | COC(=O)c1c(C(O)CC[Si](C)(C)C)nc(=O)n(C(=O)Oc2ccc([N+](=O)[O-])cc2)c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H25F2N3O8Si/c1-37-23(32)20-21(19(31)11-12-39(2,3)4)28-24(33)29(22(20)14-5-10-17(26)18(27)13-14)25(34)38-16-8-6-15(7-9-16)30(35)36/h5-10,13,19,31H,11-12H2,1-4H3 |
| InChIKey | HCYPRNUAQXHBMT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|