C22H18F3N3O8 — CID 70120315
5-O-methyl 1-O-(4-nitrophenyl) 2,4-dimethoxy-6-methyl-6-(2,3,6-trifluorophenyl)pyrimidine-1,5-dicarboxylate (PubChem CID 70120315) has the molecular formula C22H18F3N3O8 and a molecular weight of 509.39 g/mol. Its IUPAC name is 5-O-methyl 1-O-(4-nitrophenyl) 2,4-dimethoxy-6-methyl-6-(2,3,6-trifluorophenyl)pyrimidine-1,5-dicarboxylate.
| Compound Name | 5-O-methyl 1-O-(4-nitrophenyl) 2,4-dimethoxy-6-methyl-6-(2,3,6-trifluorophenyl)pyrimidine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 70120315 |
| Molecular Formula | C22H18F3N3O8 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 5-O-methyl 1-O-(4-nitrophenyl) 2,4-dimethoxy-6-methyl-6-(2,3,6-trifluorophenyl)pyrimidine-1,5-dicarboxylate |
| SMILES | COC(=O)C1=C(OC)N=C(OC)N(C(=O)Oc2ccc([N+](=O)[O-])cc2)C1(C)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C22H18F3N3O8/c1-22(15-13(23)9-10-14(24)17(15)25)16(19(29)34-3)18(33-2)26-20(35-4)27(22)21(30)36-12-7-5-11(6-8-12)28(31)32/h5-10H,1-4H3 |
| InChIKey | DKGSUHIWFBTNSX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 129.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|